C18H19NO3S2 — CID 166237899
[4-(pyridin-3-ylmethoxy)phenyl]methyl 1,3-dithiane-2-carboxylate (PubChem CID 166237899) has the molecular formula C18H19NO3S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is [4-(pyridin-3-ylmethoxy)phenyl]methyl 1,3-dithiane-2-carboxylate.
| Compound Name | [4-(pyridin-3-ylmethoxy)phenyl]methyl 1,3-dithiane-2-carboxylate |
|---|---|
| PubChem CID | 166237899 |
| Molecular Formula | C18H19NO3S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | [4-(pyridin-3-ylmethoxy)phenyl]methyl 1,3-dithiane-2-carboxylate |
| SMILES | O=C(OCc1ccc(OCc2cccnc2)cc1)C1SCCCS1 |
| InChI | InChI=1S/C18H19NO3S2/c20-17(18-23-9-2-10-24-18)22-12-14-4-6-16(7-5-14)21-13-15-3-1-8-19-11-15/h1,3-8,11,18H,2,9-10,12-13H2 |
| InChIKey | NECLZJFKWAXSRI-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |