C18H20ClN3O5 — CID 167944055
1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea (PubChem CID 167944055) has the molecular formula C18H20ClN3O5 and a molecular weight of 393.83 g/mol. Its IUPAC name is 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea.
| Compound Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea |
|---|---|
| PubChem CID | 167944055 |
| Molecular Formula | C18H20ClN3O5 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methyl]-3-[(2,5-dimethylfuran-3-carbonyl)amino]urea |
| SMILES | Cc1cc(C(=O)NNC(=O)NCc2cc(Cl)c3c(c2)OCCCO3)c(C)o1 |
| InChI | InChI=1S/C18H20ClN3O5/c1-10-6-13(11(2)27-10)17(23)21-22-18(24)20-9-12-7-14(19)16-15(8-12)25-4-3-5-26-16/h6-8H,3-5,9H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | SDSHRVLHCNDLIL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 101.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|