C17H15ClN4O — CID 167945323
[4-chloro-6-[(5-phenylpyrazin-2-yl)methylamino]-2-pyridinyl]methanol (PubChem CID 167945323) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is [4-chloro-6-[(5-phenylpyrazin-2-yl)methylamino]-2-pyridinyl]methanol.
| Compound Name | [4-chloro-6-[(5-phenylpyrazin-2-yl)methylamino]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 167945323 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | [4-chloro-6-[(5-phenylpyrazin-2-yl)methylamino]-2-pyridinyl]methanol |
| SMILES | OCc1cc(Cl)cc(NCc2cnc(-c3ccccc3)cn2)n1 |
| InChI | InChI=1S/C17H15ClN4O/c18-13-6-14(11-23)22-17(7-13)21-9-15-8-20-16(10-19-15)12-4-2-1-3-5-12/h1-8,10,23H,9,11H2,(H,21,22) |
| InChIKey | YQOSLZWBCZDPSZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |