C20H21NO3 — CID 167945324
3-[2-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]ethyl]benzoic acid (PubChem CID 167945324) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-[2-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]ethyl]benzoic acid.
| Compound Name | 3-[2-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 167945324 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-[2-[(5,6-dimethyl-1-benzofuran-2-yl)methylamino]ethyl]benzoic acid |
| SMILES | Cc1cc2cc(CNCCc3cccc(C(=O)O)c3)oc2cc1C |
| InChI | InChI=1S/C20H21NO3/c1-13-8-17-11-18(24-19(17)9-14(13)2)12-21-7-6-15-4-3-5-16(10-15)20(22)23/h3-5,8-11,21H,6-7,12H2,1-2H3,(H,22,23) |
| InChIKey | HUBKIHGETFPXFN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|