About (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone
(2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone (PubChem CID 167946416) has the molecular formula C12H15F3N2O4
and a molecular weight of 308.26 g/mol. Its IUPAC name is (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone.
Molecular Properties
| Compound Name | (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone |
| PubChem CID | 167946416 |
| Molecular Formula | C12H15F3N2O4 |
| Molecular Weight | 308.26 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone |
| SMILES | CCOc1nc(C(=O)N2CCO[C@@H](C)[C@H]2C(F)(F)F)co1 |
| InChI | InChI=1S/C12H15F3N2O4/c1-3-19-11-16-8(6-21-11)10(18)17-4-5-20-7(2)9(17)12(13,14)15/h6-7,9H,3-5H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | RYAYMGQYGCWGHD-CBAPKCEASA-N |
| XLogP | 1.87 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone?
The IUPAC name of (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone (CID 167946416) is (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone.
What is the SMILES notation for (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone?
The canonical SMILES for (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone is CCOc1nc(C(=O)N2CCO[C@@H](C)[C@H]2C(F)(F)F)co1.
What is the InChIKey of (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone?
The InChIKey is RYAYMGQYGCWGHD-CBAPKCEASA-N. The full InChI is InChI=1S/C12H15F3N2O4/c1-3-19-11-16-8(6-21-11)10(18)17-4-5-20-7(2)9(17)12(13,14)15/h6-7,9H,3-5H2,1-2H3/t7-,9-/m0/s1.
What are the key properties of (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone?
(2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone has a molecular weight of 308.26 g/mol, XLogP of 1.87, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-1,3-oxazol-4-yl)-[(2S,3S)-2-methyl-3-(trifluoromethyl)morpholin-4-yl]methanone is sourced from PubChem (CID 167946416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).