C12H12F3N3O2 — CID 167946676
5-(1-methoxyethyl)-2-[2-(trifluoromethyl)-4-pyridinyl]-4H-pyrazol-3-one (PubChem CID 167946676) has the molecular formula C12H12F3N3O2 and a molecular weight of 287.24 g/mol. Its IUPAC name is 5-(1-methoxyethyl)-2-[2-(trifluoromethyl)-4-pyridinyl]-4H-pyrazol-3-one.
| Compound Name | 5-(1-methoxyethyl)-2-[2-(trifluoromethyl)-4-pyridinyl]-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 167946676 |
| Molecular Formula | C12H12F3N3O2 |
| Molecular Weight | 287.24 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-(1-methoxyethyl)-2-[2-(trifluoromethyl)-4-pyridinyl]-4H-pyrazol-3-one |
| SMILES | COC(C)C1=NN(c2ccnc(C(F)(F)F)c2)C(=O)C1 |
| InChI | InChI=1S/C12H12F3N3O2/c1-7(20-2)9-6-11(19)18(17-9)8-3-4-16-10(5-8)12(13,14)15/h3-5,7H,6H2,1-2H3 |
| InChIKey | CJRRJUUEZVLTMD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |