C10H16Cl2N2O2 — CID 167947409
4,4-dichloro-N-[(4-methylmorpholin-2-yl)methyl]but-3-enamide (PubChem CID 167947409) has the molecular formula C10H16Cl2N2O2 and a molecular weight of 267.16 g/mol. Its IUPAC name is 4,4-dichloro-N-[(4-methylmorpholin-2-yl)methyl]but-3-enamide.
| Compound Name | 4,4-dichloro-N-[(4-methylmorpholin-2-yl)methyl]but-3-enamide |
|---|---|
| PubChem CID | 167947409 |
| Molecular Formula | C10H16Cl2N2O2 |
| Molecular Weight | 267.16 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4,4-dichloro-N-[(4-methylmorpholin-2-yl)methyl]but-3-enamide |
| SMILES | CN1CCOC(CNC(=O)CC=C(Cl)Cl)C1 |
| InChI | InChI=1S/C10H16Cl2N2O2/c1-14-4-5-16-8(7-14)6-13-10(15)3-2-9(11)12/h2,8H,3-7H2,1H3,(H,13,15) |
| InChIKey | VVZDQBQBKKFBIM-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |