C22H21N3O2 — CID 167948941
5-[3-[(3-pyridin-2-yloxyphenyl)methylamino]phenyl]pyrrolidin-2-one (PubChem CID 167948941) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-[3-[(3-pyridin-2-yloxyphenyl)methylamino]phenyl]pyrrolidin-2-one.
| Compound Name | 5-[3-[(3-pyridin-2-yloxyphenyl)methylamino]phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 167948941 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 5-[3-[(3-pyridin-2-yloxyphenyl)methylamino]phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(c2cccc(NCc3cccc(Oc4ccccn4)c3)c2)N1 |
| InChI | InChI=1S/C22H21N3O2/c26-21-11-10-20(25-21)17-6-4-7-18(14-17)24-15-16-5-3-8-19(13-16)27-22-9-1-2-12-23-22/h1-9,12-14,20,24H,10-11,15H2,(H,25,26) |
| InChIKey | VFAOQFLUWQSHKX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |