About 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one
5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one (PubChem CID 167950434) has the molecular formula C18H18N4O
and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one |
| PubChem CID | 167950434 |
| Molecular Formula | C18H18N4O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one |
| SMILES | O=C1CCC(c2cccc(NCc3ccnc4[nH]ccc34)c2)N1 |
| InChI | InChI=1S/C18H18N4O/c23-17-5-4-16(22-17)12-2-1-3-14(10-12)21-11-13-6-8-19-18-15(13)7-9-20-18/h1-3,6-10,16,21H,4-5,11H2,(H,19,20)(H,22,23) |
| InChIKey | UFSWLWABCMSEIB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one?
The IUPAC name of 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one (CID 167950434) is 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one.
What is the SMILES notation for 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one?
The canonical SMILES for 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one is O=C1CCC(c2cccc(NCc3ccnc4[nH]ccc34)c2)N1.
What is the InChIKey of 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one?
The InChIKey is UFSWLWABCMSEIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N4O/c23-17-5-4-16(22-17)12-2-1-3-14(10-12)21-11-13-6-8-19-18-15(13)7-9-20-18/h1-3,6-10,16,21H,4-5,11H2,(H,19,20)(H,22,23).
What are the key properties of 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one?
5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one has a molecular weight of 306.37 g/mol, XLogP of 3.13, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylamino)phenyl]pyrrolidin-2-one is sourced from PubChem (CID 167950434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).