C22H21N5O2 — CID 71555520
3-cyclopropyl-N-[3-[(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamoylamino)methyl]phenyl]prop-2-ynamide (PubChem CID 71555520) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3-cyclopropyl-N-[3-[(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamoylamino)methyl]phenyl]prop-2-ynamide.
| Compound Name | 3-cyclopropyl-N-[3-[(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamoylamino)methyl]phenyl]prop-2-ynamide |
|---|---|
| PubChem CID | 71555520 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 3-cyclopropyl-N-[3-[(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamoylamino)methyl]phenyl]prop-2-ynamide |
| SMILES | O=C(C#CC1CC1)Nc1cccc(CNC(=O)NCc2ccnc3[nH]ccc23)c1 |
| InChI | InChI=1S/C22H21N5O2/c28-20(7-6-15-4-5-15)27-18-3-1-2-16(12-18)13-25-22(29)26-14-17-8-10-23-21-19(17)9-11-24-21/h1-3,8-12,15H,4-5,13-14H2,(H,23,24)(H,27,28)(H2,25,26,29) |
| InChIKey | JPTHVLGZBNERHD-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 98.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|