C22H21N5O2 — CID 71554929
1-[1-(3-phenylprop-2-ynoyl)pyrrolidin-3-yl]-3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)urea (PubChem CID 71554929) has the molecular formula C22H21N5O2 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[1-(3-phenylprop-2-ynoyl)pyrrolidin-3-yl]-3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)urea.
| Compound Name | 1-[1-(3-phenylprop-2-ynoyl)pyrrolidin-3-yl]-3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)urea |
|---|---|
| PubChem CID | 71554929 |
| Molecular Formula | C22H21N5O2 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 1-[1-(3-phenylprop-2-ynoyl)pyrrolidin-3-yl]-3-(1H-pyrrolo[2,3-b]pyridin-4-ylmethyl)urea |
| SMILES | O=C(NCc1ccnc2[nH]ccc12)NC1CCN(C(=O)C#Cc2ccccc2)C1 |
| InChI | InChI=1S/C22H21N5O2/c28-20(7-6-16-4-2-1-3-5-16)27-13-10-18(15-27)26-22(29)25-14-17-8-11-23-21-19(17)9-12-24-21/h1-5,8-9,11-12,18H,10,13-15H2,(H,23,24)(H2,25,26,29) |
| InChIKey | MRZCCAFLISDHBX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|