C20H18FN5OS — CID 71555236
3-(4-fluorophenyl)-N-[2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamothioylamino)ethyl]prop-2-ynamide (PubChem CID 71555236) has the molecular formula C20H18FN5OS and a molecular weight of 395.46 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamothioylamino)ethyl]prop-2-ynamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamothioylamino)ethyl]prop-2-ynamide |
|---|---|
| PubChem CID | 71555236 |
| Molecular Formula | C20H18FN5OS |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-(1H-pyrrolo[2,3-b]pyridin-4-ylmethylcarbamothioylamino)ethyl]prop-2-ynamide |
| SMILES | O=C(C#Cc1ccc(F)cc1)NCCNC(=S)NCc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C20H18FN5OS/c21-16-4-1-14(2-5-16)3-6-18(27)22-11-12-25-20(28)26-13-15-7-9-23-19-17(15)8-10-24-19/h1-2,4-5,7-10H,11-13H2,(H,22,27)(H,23,24)(H2,25,26,28) |
| InChIKey | ZWKUQKUFPJCBRQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|