C24H23FN2OS — CID 162054535
1-(2-fluorophenyl)-11-(1H-pyrrolo[2,3-b]pyridin-4-yl)-9-sulfanylideneundec-1-yn-3-one (PubChem CID 162054535) has the molecular formula C24H23FN2OS and a molecular weight of 406.53 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-11-(1H-pyrrolo[2,3-b]pyridin-4-yl)-9-sulfanylideneundec-1-yn-3-one.
| Compound Name | 1-(2-fluorophenyl)-11-(1H-pyrrolo[2,3-b]pyridin-4-yl)-9-sulfanylideneundec-1-yn-3-one |
|---|---|
| PubChem CID | 162054535 |
| Molecular Formula | C24H23FN2OS |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 1-(2-fluorophenyl)-11-(1H-pyrrolo[2,3-b]pyridin-4-yl)-9-sulfanylideneundec-1-yn-3-one |
| SMILES | O=C(C#Cc1ccccc1F)CCCCCC(=S)CCc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C24H23FN2OS/c25-23-9-5-4-6-19(23)10-12-20(28)7-2-1-3-8-21(29)13-11-18-14-16-26-24-22(18)15-17-27-24/h4-6,9,14-17H,1-3,7-8,11,13H2,(H,26,27) |
| InChIKey | JIELCGSJNNBXKC-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|