About 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione
7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione (PubChem CID 158768412) has the molecular formula C14H19N3S
and a molecular weight of 261.39 g/mol. Its IUPAC name is 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione.
Molecular Properties
| Compound Name | 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione |
| PubChem CID | 158768412 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione |
| SMILES | NCCCCC(=S)CCc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C14H19N3S/c15-8-2-1-3-12(18)5-4-11-6-9-16-14-13(11)7-10-17-14/h6-7,9-10H,1-5,8,15H2,(H,16,17) |
| InChIKey | QTQSDWYIHFTHNR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione?
The IUPAC name of 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione (CID 158768412) is 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione.
What is the SMILES notation for 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione?
The canonical SMILES for 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione is NCCCCC(=S)CCc1ccnc2[nH]ccc12.
What is the InChIKey of 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione?
The InChIKey is QTQSDWYIHFTHNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3S/c15-8-2-1-3-12(18)5-4-11-6-9-16-14-13(11)7-10-17-14/h6-7,9-10H,1-5,8,15H2,(H,16,17).
What are the key properties of 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione?
7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione has a molecular weight of 261.39 g/mol, XLogP of 2.99, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione is sourced from PubChem (CID 158768412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).