C14H19N3S — CID 158768412
7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione (PubChem CID 158768412) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione.
| Compound Name | 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione |
|---|---|
| PubChem CID | 158768412 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 7-amino-1-(1H-pyrrolo[2,3-b]pyridin-4-yl)heptane-3-thione |
| SMILES | NCCCCC(=S)CCc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C14H19N3S/c15-8-2-1-3-12(18)5-4-11-6-9-16-14-13(11)7-10-17-14/h6-7,9-10H,1-5,8,15H2,(H,16,17) |
| InChIKey | QTQSDWYIHFTHNR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|