C11H9N3 — CID 118078364
4-pyrrol-1-yl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 118078364) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4-pyrrol-1-yl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 4-pyrrol-1-yl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 118078364 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4-pyrrol-1-yl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | c1ccn(-c2ccnc3[nH]ccc23)c1 |
| InChI | InChI=1S/C11H9N3/c1-2-8-14(7-1)10-4-6-13-11-9(10)3-5-12-11/h1-8H,(H,12,13) |
| InChIKey | DKIGTQZEHGCFKE-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |