C17H17N3O3 — CID 167991293
4-methoxy-N-[3-(5-oxopyrrolidin-2-yl)phenyl]pyridine-3-carboxamide (PubChem CID 167991293) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-methoxy-N-[3-(5-oxopyrrolidin-2-yl)phenyl]pyridine-3-carboxamide.
| Compound Name | 4-methoxy-N-[3-(5-oxopyrrolidin-2-yl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167991293 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 4-methoxy-N-[3-(5-oxopyrrolidin-2-yl)phenyl]pyridine-3-carboxamide |
| SMILES | COc1ccncc1C(=O)Nc1cccc(C2CCC(=O)N2)c1 |
| InChI | InChI=1S/C17H17N3O3/c1-23-15-7-8-18-10-13(15)17(22)19-12-4-2-3-11(9-12)14-5-6-16(21)20-14/h2-4,7-10,14H,5-6H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | FMVPRRJXHKRASX-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |