C17H24N4O — CID 167949484
N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxan-3-yl]methyl]-2-pyridin-2-ylethanamine (PubChem CID 167949484) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxan-3-yl]methyl]-2-pyridin-2-ylethanamine.
| Compound Name | N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxan-3-yl]methyl]-2-pyridin-2-ylethanamine |
|---|---|
| PubChem CID | 167949484 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-[[(2R,3S)-2-(2-methylpyrazol-3-yl)oxan-3-yl]methyl]-2-pyridin-2-ylethanamine |
| SMILES | Cn1nccc1[C@@H]1OCCC[C@H]1CNCCc1ccccn1 |
| InChI | InChI=1S/C17H24N4O/c1-21-16(8-11-20-21)17-14(5-4-12-22-17)13-18-10-7-15-6-2-3-9-19-15/h2-3,6,8-9,11,14,17-18H,4-5,7,10,12-13H2,1H3/t14-,17+/m0/s1 |
| InChIKey | FYEXAEFMEIJAHB-WMLDXEAASA-N |
| XLogP | 2.12 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|