About 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine
6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine (PubChem CID 167950849) has the molecular formula C14H18FN5O
and a molecular weight of 291.33 g/mol. Its IUPAC name is 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine |
| PubChem CID | 167950849 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine |
| SMILES | CCc1ncnc(NC[C@H]2CCO[C@@H]2c2cn[nH]c2)c1F |
| InChI | InChI=1S/C14H18FN5O/c1-2-11-12(15)14(18-8-17-11)16-5-9-3-4-21-13(9)10-6-19-20-7-10/h6-9,13H,2-5H2,1H3,(H,19,20)(H,16,17,18)/t9-,13+/m1/s1 |
| InChIKey | UQGJUGXIHFYBHF-RNCFNFMXSA-N |
| XLogP | 2.09 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine?
The IUPAC name of 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine (CID 167950849) is 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine?
The canonical SMILES for 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine is CCc1ncnc(NC[C@H]2CCO[C@@H]2c2cn[nH]c2)c1F.
What is the InChIKey of 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine?
The InChIKey is UQGJUGXIHFYBHF-RNCFNFMXSA-N. The full InChI is InChI=1S/C14H18FN5O/c1-2-11-12(15)14(18-8-17-11)16-5-9-3-4-21-13(9)10-6-19-20-7-10/h6-9,13H,2-5H2,1H3,(H,19,20)(H,16,17,18)/t9-,13+/m1/s1.
What are the key properties of 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine?
6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine has a molecular weight of 291.33 g/mol, XLogP of 2.09, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-fluoro-N-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methyl]pyrimidin-4-amine is sourced from PubChem (CID 167950849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).