About 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile
6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile (PubChem CID 154761469) has the molecular formula C14H16N6O
and a molecular weight of 284.32 g/mol. Its IUPAC name is 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile |
| PubChem CID | 154761469 |
| Molecular Formula | C14H16N6O |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile |
| SMILES | Cc1cc(C#N)nc(NC[C@H]2CCO[C@@H]2c2cn[nH]c2)n1 |
| InChI | InChI=1S/C14H16N6O/c1-9-4-12(5-15)20-14(19-9)16-6-10-2-3-21-13(10)11-7-17-18-8-11/h4,7-8,10,13H,2-3,6H2,1H3,(H,17,18)(H,16,19,20)/t10-,13+/m1/s1 |
| InChIKey | RHQSDHRDLKELHC-MFKMUULPSA-N |
| XLogP | 1.57 |
| TPSA | 99.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile?
The IUPAC name of 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile (CID 154761469) is 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile.
What is the SMILES notation for 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile?
The canonical SMILES for 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile is Cc1cc(C#N)nc(NC[C@H]2CCO[C@@H]2c2cn[nH]c2)n1.
What is the InChIKey of 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile?
The InChIKey is RHQSDHRDLKELHC-MFKMUULPSA-N. The full InChI is InChI=1S/C14H16N6O/c1-9-4-12(5-15)20-14(19-9)16-6-10-2-3-21-13(10)11-7-17-18-8-11/h4,7-8,10,13H,2-3,6H2,1H3,(H,17,18)(H,16,19,20)/t10-,13+/m1/s1.
What are the key properties of 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile?
6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile has a molecular weight of 284.32 g/mol, XLogP of 1.57, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2-[[(2S,3R)-2-(1H-pyrazol-4-yl)oxolan-3-yl]methylamino]pyrimidine-4-carbonitrile is sourced from PubChem (CID 154761469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).