C19H17N3O2 — CID 167951604
3-amino-4-[(9-ethylcarbazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione (PubChem CID 167951604) has the molecular formula C19H17N3O2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 3-amino-4-[(9-ethylcarbazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-amino-4-[(9-ethylcarbazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 167951604 |
| Molecular Formula | C19H17N3O2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-amino-4-[(9-ethylcarbazol-3-yl)methylamino]cyclobut-3-ene-1,2-dione |
| SMILES | CCn1c2ccccc2c2cc(CNc3c(N)c(=O)c3=O)ccc21 |
| InChI | InChI=1S/C19H17N3O2/c1-2-22-14-6-4-3-5-12(14)13-9-11(7-8-15(13)22)10-21-17-16(20)18(23)19(17)24/h3-9,21H,2,10,20H2,1H3 |
| InChIKey | IWLVHTBJKOFZFO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|