C24H22N8O4 — CID 167952298
3-[3-oxo-5-[4-(3-pyrazin-2-ylpyrrolidine-1-carbonyl)triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167952298) has the molecular formula C24H22N8O4 and a molecular weight of 486.49 g/mol. Its IUPAC name is 3-[3-oxo-5-[4-(3-pyrazin-2-ylpyrrolidine-1-carbonyl)triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-5-[4-(3-pyrazin-2-ylpyrrolidine-1-carbonyl)triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167952298 |
| Molecular Formula | C24H22N8O4 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-[3-oxo-5-[4-(3-pyrazin-2-ylpyrrolidine-1-carbonyl)triazol-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(-n4cc(C(=O)N5CCC(c6cnccn6)C5)nn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H22N8O4/c33-21-4-3-20(22(34)27-21)31-12-14-1-2-16(9-17(14)23(31)35)32-13-19(28-29-32)24(36)30-8-5-15(11-30)18-10-25-6-7-26-18/h1-2,6-7,9-10,13,15,20H,3-5,8,11-12H2,(H,27,33,34) |
| InChIKey | WQPXOPMDEJBZSK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 143.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|