C23H21N5O3 — CID 167953745
3-[3-oxo-6-[(2-pyrazol-1-ylphenyl)methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167953745) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 3-[3-oxo-6-[(2-pyrazol-1-ylphenyl)methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[(2-pyrazol-1-ylphenyl)methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167953745 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 3-[3-oxo-6-[(2-pyrazol-1-ylphenyl)methylamino]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(NCc4ccccc4-n4cccn4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H21N5O3/c29-21-9-8-20(22(30)26-21)27-14-16-12-17(6-7-18(16)23(27)31)24-13-15-4-1-2-5-19(15)28-11-3-10-25-28/h1-7,10-12,20,24H,8-9,13-14H2,(H,26,29,30) |
| InChIKey | XDYOJQQABZFUMP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|