C15H14F6N4O4 — CID 167954342
2-[(4-methyl-1,2-oxazol-3-yl)methyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-1-one;2,2,2-trifluoroacetic acid (PubChem CID 167954342) has the molecular formula C15H14F6N4O4 and a molecular weight of 428.29 g/mol. Its IUPAC name is 2-[(4-methyl-1,2-oxazol-3-yl)methyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-1-one;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(4-methyl-1,2-oxazol-3-yl)methyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-1-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167954342 |
| Molecular Formula | C15H14F6N4O4 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-[(4-methyl-1,2-oxazol-3-yl)methyl]-4-(trifluoromethyl)-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-1-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1conc1Cn1nc(C(F)(F)F)c2c(c1=O)CCNC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N4O2.C2HF3O2/c1-7-6-22-19-10(7)5-20-12(21)8-2-3-17-4-9(8)11(18-20)13(14,15)16;3-2(4,5)1(6)7/h6,17H,2-5H2,1H3;(H,6,7) |
| InChIKey | YNPOOGWVTIUYQQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |