C18H18N4O2S — CID 167955554
N-[4-(ethylsulfanylmethyl)-2-pyridinyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide (PubChem CID 167955554) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[4-(ethylsulfanylmethyl)-2-pyridinyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-[4-(ethylsulfanylmethyl)-2-pyridinyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 167955554 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[4-(ethylsulfanylmethyl)-2-pyridinyl]-2-(4-oxo-3H-phthalazin-1-yl)acetamide |
| SMILES | CCSCc1ccnc(NC(=O)Cc2n[nH]c(=O)c3ccccc23)c1 |
| InChI | InChI=1S/C18H18N4O2S/c1-2-25-11-12-7-8-19-16(9-12)20-17(23)10-15-13-5-3-4-6-14(13)18(24)22-21-15/h3-9H,2,10-11H2,1H3,(H,22,24)(H,19,20,23) |
| InChIKey | QYMGJCNFMCTFCB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |