C21H23N5O — CID 167955612
1-[1-[2-(3-methylphenyl)cyclopropyl]ethyl]-3-(1-pyridin-4-ylpyrazol-4-yl)urea (PubChem CID 167955612) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is 1-[1-[2-(3-methylphenyl)cyclopropyl]ethyl]-3-(1-pyridin-4-ylpyrazol-4-yl)urea.
| Compound Name | 1-[1-[2-(3-methylphenyl)cyclopropyl]ethyl]-3-(1-pyridin-4-ylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 167955612 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-[1-[2-(3-methylphenyl)cyclopropyl]ethyl]-3-(1-pyridin-4-ylpyrazol-4-yl)urea |
| SMILES | Cc1cccc(C2CC2C(C)NC(=O)Nc2cnn(-c3ccncc3)c2)c1 |
| InChI | InChI=1S/C21H23N5O/c1-14-4-3-5-16(10-14)20-11-19(20)15(2)24-21(27)25-17-12-23-26(13-17)18-6-8-22-9-7-18/h3-10,12-13,15,19-20H,11H2,1-2H3,(H2,24,25,27) |
| InChIKey | UFATWLXCBYOUHT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |