C24H27N5O3 — CID 117076294
N-(4-hydroxycyclohexyl)-3-[4-[(3-methylphenyl)carbamoylamino]pyrazol-1-yl]benzamide (PubChem CID 117076294) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(4-hydroxycyclohexyl)-3-[4-[(3-methylphenyl)carbamoylamino]pyrazol-1-yl]benzamide.
| Compound Name | N-(4-hydroxycyclohexyl)-3-[4-[(3-methylphenyl)carbamoylamino]pyrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 117076294 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-(4-hydroxycyclohexyl)-3-[4-[(3-methylphenyl)carbamoylamino]pyrazol-1-yl]benzamide |
| SMILES | Cc1cccc(NC(=O)Nc2cnn(-c3cccc(C(=O)NC4CCC(O)CC4)c3)c2)c1 |
| InChI | InChI=1S/C24H27N5O3/c1-16-4-2-6-19(12-16)27-24(32)28-20-14-25-29(15-20)21-7-3-5-17(13-21)23(31)26-18-8-10-22(30)11-9-18/h2-7,12-15,18,22,30H,8-11H2,1H3,(H,26,31)(H2,27,28,32) |
| InChIKey | OLNVUXTZDWLQTG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |