C26H24N4O2 — CID 42344718
N-benzyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide (PubChem CID 42344718) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is N-benzyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide.
| Compound Name | N-benzyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 42344718 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-benzyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide |
| SMILES | Cc1cccc(CC(=O)Nc2cnn(-c3cccc(C(=O)NCc4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C26H24N4O2/c1-19-7-5-10-21(13-19)14-25(31)29-23-17-28-30(18-23)24-12-6-11-22(15-24)26(32)27-16-20-8-3-2-4-9-20/h2-13,15,17-18H,14,16H2,1H3,(H,27,32)(H,29,31) |
| InChIKey | CTKOBWZSNHWRDE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |