C25H28N4O2 — CID 117074983
N-cyclohexyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide (PubChem CID 117074983) has the molecular formula C25H28N4O2 and a molecular weight of 416.53 g/mol. Its IUPAC name is N-cyclohexyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide.
| Compound Name | N-cyclohexyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 117074983 |
| Molecular Formula | C25H28N4O2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-cyclohexyl-3-[4-[[2-(3-methylphenyl)acetyl]amino]pyrazol-1-yl]benzamide |
| SMILES | Cc1cccc(CC(=O)Nc2cnn(-c3cccc(C(=O)NC4CCCCC4)c3)c2)c1 |
| InChI | InChI=1S/C25H28N4O2/c1-18-7-5-8-19(13-18)14-24(30)27-22-16-26-29(17-22)23-12-6-9-20(15-23)25(31)28-21-10-3-2-4-11-21/h5-9,12-13,15-17,21H,2-4,10-11,14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | ZCXRJHLMXQTAMM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |