C31H27N3O2 — CID 167956083
4-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-phenylphenyl)phenyl]butanamide (PubChem CID 167956083) has the molecular formula C31H27N3O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is 4-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-phenylphenyl)phenyl]butanamide.
| Compound Name | 4-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-phenylphenyl)phenyl]butanamide |
|---|---|
| PubChem CID | 167956083 |
| Molecular Formula | C31H27N3O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 4-(2-methyl-4-oxoquinazolin-3-yl)-N-[2-(4-phenylphenyl)phenyl]butanamide |
| SMILES | Cc1nc2ccccc2c(=O)n1CCCC(=O)Nc1ccccc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C31H27N3O2/c1-22-32-29-15-8-6-13-27(29)31(36)34(22)21-9-16-30(35)33-28-14-7-5-12-26(28)25-19-17-24(18-20-25)23-10-3-2-4-11-23/h2-8,10-15,17-20H,9,16,21H2,1H3,(H,33,35) |
| InChIKey | XAFPCDFRXICJLQ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |