C22H31N3O4 — CID 71851736
methyl 8-[4-(2-methyl-4-oxoquinazolin-3-yl)butanoylamino]octanoate (PubChem CID 71851736) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 8-[4-(2-methyl-4-oxoquinazolin-3-yl)butanoylamino]octanoate.
| Compound Name | methyl 8-[4-(2-methyl-4-oxoquinazolin-3-yl)butanoylamino]octanoate |
|---|---|
| PubChem CID | 71851736 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | methyl 8-[4-(2-methyl-4-oxoquinazolin-3-yl)butanoylamino]octanoate |
| SMILES | COC(=O)CCCCCCCNC(=O)CCCn1c(C)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H31N3O4/c1-17-24-19-12-8-7-11-18(19)22(28)25(17)16-10-13-20(26)23-15-9-5-3-4-6-14-21(27)29-2/h7-8,11-12H,3-6,9-10,13-16H2,1-2H3,(H,23,26) |
| InChIKey | HLWLAYVJNBZPGD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|