C23H27N3O3 — CID 7201872
methyl 4-[4-oxo-2-[(1S)-1-(2-phenylethylamino)ethyl]quinazolin-3-yl]butanoate (PubChem CID 7201872) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is methyl 4-[4-oxo-2-[(1S)-1-(2-phenylethylamino)ethyl]quinazolin-3-yl]butanoate.
| Compound Name | methyl 4-[4-oxo-2-[(1S)-1-(2-phenylethylamino)ethyl]quinazolin-3-yl]butanoate |
|---|---|
| PubChem CID | 7201872 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | methyl 4-[4-oxo-2-[(1S)-1-(2-phenylethylamino)ethyl]quinazolin-3-yl]butanoate |
| SMILES | COC(=O)CCCn1c([C@H](C)NCCc2ccccc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H27N3O3/c1-17(24-15-14-18-9-4-3-5-10-18)22-25-20-12-7-6-11-19(20)23(28)26(22)16-8-13-21(27)29-2/h3-7,9-12,17,24H,8,13-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | PIVYXHWIQMTKOW-KRWDZBQOSA-N |
| XLogP | 3.24 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |