About methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate
methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate (PubChem CID 23381326) has the molecular formula C25H35N5O3
and a molecular weight of 453.59 g/mol. Its IUPAC name is methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate.
Molecular Properties
| Compound Name | methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate |
| PubChem CID | 23381326 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate |
| SMILES | COC(=O)CCCCCCCCC(=O)NCCCCn1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C25H35N5O3/c1-33-22(32)15-7-5-3-2-4-6-14-21(31)27-16-10-11-17-30-18-28-23-24(30)19-12-8-9-13-20(19)29-25(23)26/h8-9,12-13,18H,2-7,10-11,14-17H2,1H3,(H2,26,29)(H,27,31) |
| InChIKey | GDENZDBPZIHSEH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 112.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate?
The IUPAC name of methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate (CID 23381326) is methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate.
What is the SMILES notation for methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate?
The canonical SMILES for methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate is COC(=O)CCCCCCCCC(=O)NCCCCn1cnc2c(N)nc3ccccc3c21.
What is the InChIKey of methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate?
The InChIKey is GDENZDBPZIHSEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H35N5O3/c1-33-22(32)15-7-5-3-2-4-6-14-21(31)27-16-10-11-17-30-18-28-23-24(30)19-12-8-9-13-20(19)29-25(23)26/h8-9,12-13,18H,2-7,10-11,14-17H2,1H3,(H2,26,29)(H,27,31).
What are the key properties of methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate?
methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate has a molecular weight of 453.59 g/mol, XLogP of 4.36, 14 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 10-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butylamino]-10-oxodecanoate is sourced from PubChem (CID 23381326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).