C34H40N6O2 — CID 15453778
N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-[2-(dimethylamino)ethoxy-phenylmethyl]phenyl]propanamide (PubChem CID 15453778) has the molecular formula C34H40N6O2 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-[2-(dimethylamino)ethoxy-phenylmethyl]phenyl]propanamide.
| Compound Name | N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-[2-(dimethylamino)ethoxy-phenylmethyl]phenyl]propanamide |
|---|---|
| PubChem CID | 15453778 |
| Molecular Formula | C34H40N6O2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-[4-[2-(dimethylamino)ethoxy-phenylmethyl]phenyl]propanamide |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccc(CCC(=O)NCCCCn2cnc3c(N)nc4ccccc4c32)cc1 |
| InChI | InChI=1S/C34H40N6O2/c1-39(2)22-23-42-33(26-10-4-3-5-11-26)27-17-14-25(15-18-27)16-19-30(41)36-20-8-9-21-40-24-37-31-32(40)28-12-6-7-13-29(28)38-34(31)35/h3-7,10-15,17-18,24,33H,8-9,16,19-23H2,1-2H3,(H2,35,38)(H,36,41) |
| InChIKey | KHRNFIOSXZISME-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|