C22H24N6O — CID 142653136
1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea (PubChem CID 142653136) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea.
| Compound Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea |
|---|---|
| PubChem CID | 142653136 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea |
| SMILES | CNC(=O)N(CCCCn1cnc2c(N)nc3ccccc3c21)c1ccccc1 |
| InChI | InChI=1S/C22H24N6O/c1-24-22(29)28(16-9-3-2-4-10-16)14-8-7-13-27-15-25-19-20(27)17-11-5-6-12-18(17)26-21(19)23/h2-6,9-12,15H,7-8,13-14H2,1H3,(H2,23,26)(H,24,29) |
| InChIKey | PPAIFZLCJURNCU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|