About 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea
1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea (PubChem CID 142653136) has the molecular formula C22H24N6O
and a molecular weight of 388.48 g/mol. Its IUPAC name is 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea.
Molecular Properties
| Compound Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea |
| PubChem CID | 142653136 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea |
| SMILES | CNC(=O)N(CCCCn1cnc2c(N)nc3ccccc3c21)c1ccccc1 |
| InChI | InChI=1S/C22H24N6O/c1-24-22(29)28(16-9-3-2-4-10-16)14-8-7-13-27-15-25-19-20(27)17-11-5-6-12-18(17)26-21(19)23/h2-6,9-12,15H,7-8,13-14H2,1H3,(H2,23,26)(H,24,29) |
| InChIKey | PPAIFZLCJURNCU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea?
The IUPAC name of 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea (CID 142653136) is 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea.
What is the SMILES notation for 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea?
The canonical SMILES for 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea is CNC(=O)N(CCCCn1cnc2c(N)nc3ccccc3c21)c1ccccc1.
What is the InChIKey of 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea?
The InChIKey is PPAIFZLCJURNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N6O/c1-24-22(29)28(16-9-3-2-4-10-16)14-8-7-13-27-15-25-19-20(27)17-11-5-6-12-18(17)26-21(19)23/h2-6,9-12,15H,7-8,13-14H2,1H3,(H2,23,26)(H,24,29).
What are the key properties of 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea?
1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea has a molecular weight of 388.48 g/mol, XLogP of 3.79, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-methyl-1-phenylurea is sourced from PubChem (CID 142653136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).