About 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide
2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide (PubChem CID 68819765) has the molecular formula C22H22ClN5O
and a molecular weight of 407.91 g/mol. Its IUPAC name is 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide.
Molecular Properties
| Compound Name | 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide |
| PubChem CID | 68819765 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide |
| SMILES | NC(=O)c1ccc(CCl)cc1CCCCn1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C22H22ClN5O/c23-12-14-8-9-16(22(25)29)15(11-14)5-3-4-10-28-13-26-19-20(28)17-6-1-2-7-18(17)27-21(19)24/h1-2,6-9,11,13H,3-5,10,12H2,(H2,24,27)(H2,25,29) |
| InChIKey | RFIYBPGILQQMIA-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide?
The IUPAC name of 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide (CID 68819765) is 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide.
What is the SMILES notation for 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide?
The canonical SMILES for 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide is NC(=O)c1ccc(CCl)cc1CCCCn1cnc2c(N)nc3ccccc3c21.
What is the InChIKey of 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide?
The InChIKey is RFIYBPGILQQMIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22ClN5O/c23-12-14-8-9-16(22(25)29)15(11-14)5-3-4-10-28-13-26-19-20(28)17-6-1-2-7-18(17)27-21(19)24/h1-2,6-9,11,13H,3-5,10,12H2,(H2,24,27)(H2,25,29).
What are the key properties of 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide?
2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide has a molecular weight of 407.91 g/mol, XLogP of 4.03, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-4-(chloromethyl)benzamide is sourced from PubChem (CID 68819765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).