C23H25N5O2 — CID 23512668
N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2-phenoxypropanamide (PubChem CID 23512668) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2-phenoxypropanamide.
| Compound Name | N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 23512668 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-2-phenoxypropanamide |
| SMILES | CC(Oc1ccccc1)C(=O)NCCCCn1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C23H25N5O2/c1-16(30-17-9-3-2-4-10-17)23(29)25-13-7-8-14-28-15-26-20-21(28)18-11-5-6-12-19(18)27-22(20)24/h2-6,9-12,15-16H,7-8,13-14H2,1H3,(H2,24,27)(H,25,29) |
| InChIKey | BLLDZTQSNMHSCB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|