C27H26N6O2 — CID 22985743
1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-(4-phenoxyphenyl)urea (PubChem CID 22985743) has the molecular formula C27H26N6O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 22985743 |
| Molecular Formula | C27H26N6O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | 1-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]-3-(4-phenoxyphenyl)urea |
| SMILES | Nc1nc2ccccc2c2c1ncn2CCCCNC(=O)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H26N6O2/c28-26-24-25(22-10-4-5-11-23(22)32-26)33(18-30-24)17-7-6-16-29-27(34)31-19-12-14-21(15-13-19)35-20-8-2-1-3-9-20/h1-5,8-15,18H,6-7,16-17H2,(H2,28,32)(H2,29,31,34) |
| InChIKey | KFWWAELBYBLOJH-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|