C25H35N5O2 — CID 142032826
[(2S)-5-methyl-2-propan-2-ylcyclohexyl] N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]carbamate (PubChem CID 142032826) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is [(2S)-5-methyl-2-propan-2-ylcyclohexyl] N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]carbamate.
| Compound Name | [(2S)-5-methyl-2-propan-2-ylcyclohexyl] N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]carbamate |
|---|---|
| PubChem CID | 142032826 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | [(2S)-5-methyl-2-propan-2-ylcyclohexyl] N-[4-(4-aminoimidazo[4,5-c]quinolin-1-yl)butyl]carbamate |
| SMILES | CC1CC[C@@H](C(C)C)C(OC(=O)NCCCCn2cnc3c(N)nc4ccccc4c32)C1 |
| InChI | InChI=1S/C25H35N5O2/c1-16(2)18-11-10-17(3)14-21(18)32-25(31)27-12-6-7-13-30-15-28-22-23(30)19-8-4-5-9-20(19)29-24(22)26/h4-5,8-9,15-18,21H,6-7,10-14H2,1-3H3,(H2,26,29)(H,27,31)/t17?,18-,21?/m0/s1 |
| InChIKey | DRRNBPKYCFRNCR-WBTXTPOCSA-N |
| XLogP | 5.13 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|