C17H13BrF3NO3 — CID 167961153
3-bromo-4-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethoxy]-5-methoxybenzonitrile (PubChem CID 167961153) has the molecular formula C17H13BrF3NO3 and a molecular weight of 416.19 g/mol. Its IUPAC name is 3-bromo-4-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethoxy]-5-methoxybenzonitrile.
| Compound Name | 3-bromo-4-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethoxy]-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 167961153 |
| Molecular Formula | C17H13BrF3NO3 |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | 3-bromo-4-[(2R)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethoxy]-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)cc(Br)c1OC[C@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13BrF3NO3/c1-24-15-7-10(8-22)6-13(18)16(15)25-9-14(23)11-2-4-12(5-3-11)17(19,20)21/h2-7,14,23H,9H2,1H3/t14-/m0/s1 |
| InChIKey | DOJGZQOAFBHPDU-AWEZNQCLSA-N |
| XLogP | 4.46 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |