C10H12F3NO4 — CID 167962397
trans-(1R,2S)-1-(oxetan-3-ylmethylcarbamoyl)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (PubChem CID 167962397) has the molecular formula C10H12F3NO4 and a molecular weight of 267.20 g/mol. Its IUPAC name is trans-(1R,2S)-1-(oxetan-3-ylmethylcarbamoyl)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,2S)-1-(oxetan-3-ylmethylcarbamoyl)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 167962397 |
| Molecular Formula | C10H12F3NO4 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | trans-(1R,2S)-1-(oxetan-3-ylmethylcarbamoyl)-2-(trifluoromethyl)cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)[C@]1(C(=O)NCC2COC2)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO4/c11-10(12,13)6-1-9(6,8(16)17)7(15)14-2-5-3-18-4-5/h5-6H,1-4H2,(H,14,15)(H,16,17)/t6-,9+/m0/s1 |
| InChIKey | XSRFEHLPUKKOPO-IMTBSYHQSA-N |
| XLogP | 0.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|