C12H16N2O4S2 — CID 167962946
1-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid (PubChem CID 167962946) has the molecular formula C12H16N2O4S2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid.
| Compound Name | 1-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 167962946 |
| Molecular Formula | C12H16N2O4S2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 1-[2-(4-methyl-1,3-thiazol-5-yl)ethylsulfonyl]-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| SMILES | Cc1ncsc1CCS(=O)(=O)N1CC=CC(C(=O)O)C1 |
| InChI | InChI=1S/C12H16N2O4S2/c1-9-11(19-8-13-9)4-6-20(17,18)14-5-2-3-10(7-14)12(15)16/h2-3,8,10H,4-7H2,1H3,(H,15,16) |
| InChIKey | MCZJKDLCPRMAMI-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|