C14H13NO7S — CID 167963268
3-(1,3-benzodioxol-5-yl)-2-(furan-3-ylsulfonylamino)propanoic acid (PubChem CID 167963268) has the molecular formula C14H13NO7S and a molecular weight of 339.33 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-(furan-3-ylsulfonylamino)propanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-(furan-3-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 167963268 |
| Molecular Formula | C14H13NO7S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-(furan-3-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)C(Cc1ccc2c(c1)OCO2)NS(=O)(=O)c1ccoc1 |
| InChI | InChI=1S/C14H13NO7S/c16-14(17)11(15-23(18,19)10-3-4-20-7-10)5-9-1-2-12-13(6-9)22-8-21-12/h1-4,6-7,11,15H,5,8H2,(H,16,17) |
| InChIKey | FBFYJVMPAYDVKH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |