C18H20N8O — CID 167963785
1-[1-(6-anilinopyrimidin-4-yl)piperidin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 167963785) has the molecular formula C18H20N8O and a molecular weight of 364.41 g/mol. Its IUPAC name is 1-[1-(6-anilinopyrimidin-4-yl)piperidin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[1-(6-anilinopyrimidin-4-yl)piperidin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 167963785 |
| Molecular Formula | C18H20N8O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1-[1-(6-anilinopyrimidin-4-yl)piperidin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn(C2CCCN(c3cc(Nc4ccccc4)ncn3)C2)n1 |
| InChI | InChI=1S/C18H20N8O/c19-17(27)18-22-12-26(24-18)14-7-4-8-25(10-14)16-9-15(20-11-21-16)23-13-5-2-1-3-6-13/h1-3,5-6,9,11-12,14H,4,7-8,10H2,(H2,19,27)(H,20,21,23) |
| InChIKey | RGNRANANKNUQCS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 114.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |