C14H18FNO5S — CID 167964408
ethyl 4-[3-(ethylamino)-3-oxopropyl]sulfonyl-3-fluorobenzoate (PubChem CID 167964408) has the molecular formula C14H18FNO5S and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl 4-[3-(ethylamino)-3-oxopropyl]sulfonyl-3-fluorobenzoate.
| Compound Name | ethyl 4-[3-(ethylamino)-3-oxopropyl]sulfonyl-3-fluorobenzoate |
|---|---|
| PubChem CID | 167964408 |
| Molecular Formula | C14H18FNO5S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | ethyl 4-[3-(ethylamino)-3-oxopropyl]sulfonyl-3-fluorobenzoate |
| SMILES | CCNC(=O)CCS(=O)(=O)c1ccc(C(=O)OCC)cc1F |
| InChI | InChI=1S/C14H18FNO5S/c1-3-16-13(17)7-8-22(19,20)12-6-5-10(9-11(12)15)14(18)21-4-2/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | NHHFSOSDTZGIRI-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |