C18H17N3O6S — CID 22421823
ethyl 4-[3-(2,1,3-benzoxadiazol-4-ylsulfonyl)propanoylamino]benzoate (PubChem CID 22421823) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is ethyl 4-[3-(2,1,3-benzoxadiazol-4-ylsulfonyl)propanoylamino]benzoate.
| Compound Name | ethyl 4-[3-(2,1,3-benzoxadiazol-4-ylsulfonyl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 22421823 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | ethyl 4-[3-(2,1,3-benzoxadiazol-4-ylsulfonyl)propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CCS(=O)(=O)c2cccc3nonc23)cc1 |
| InChI | InChI=1S/C18H17N3O6S/c1-2-26-18(23)12-6-8-13(9-7-12)19-16(22)10-11-28(24,25)15-5-3-4-14-17(15)21-27-20-14/h3-9H,2,10-11H2,1H3,(H,19,22) |
| InChIKey | JNNYOLXQBLBHAB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 128.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |