C16H13N3O4S — CID 167967424
N-(4-methylphenyl)sulfonyl-2-pyridin-3-yl-1,3-oxazole-4-carboxamide (PubChem CID 167967424) has the molecular formula C16H13N3O4S and a molecular weight of 343.36 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-2-pyridin-3-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-2-pyridin-3-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 167967424 |
| Molecular Formula | C16H13N3O4S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-2-pyridin-3-yl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)c2coc(-c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C16H13N3O4S/c1-11-4-6-13(7-5-11)24(21,22)19-15(20)14-10-23-16(18-14)12-3-2-8-17-9-12/h2-10H,1H3,(H,19,20) |
| InChIKey | HAKFYAPQJYXWSE-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |