C12H11NO2 — CID 115084506
1-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethanone (PubChem CID 115084506) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethanone.
| Compound Name | 1-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 115084506 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 1-[2-(4-methylphenyl)-1,3-oxazol-4-yl]ethanone |
| SMILES | CC(=O)c1coc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C12H11NO2/c1-8-3-5-10(6-4-8)12-13-11(7-15-12)9(2)14/h3-7H,1-2H3 |
| InChIKey | SNCJAKNQLQEIFC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |