C9H7NO3 — CID 115083525
1-[2-(furan-2-yl)-1,3-oxazol-4-yl]ethanone (PubChem CID 115083525) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-1,3-oxazol-4-yl]ethanone.
| Compound Name | 1-[2-(furan-2-yl)-1,3-oxazol-4-yl]ethanone |
|---|---|
| PubChem CID | 115083525 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 1-[2-(furan-2-yl)-1,3-oxazol-4-yl]ethanone |
| SMILES | CC(=O)c1coc(-c2ccco2)n1 |
| InChI | InChI=1S/C9H7NO3/c1-6(11)7-5-13-9(10-7)8-3-2-4-12-8/h2-5H,1H3 |
| InChIKey | WMEGBBQRZWEVCP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 56.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |