C8H7NO3 — CID 115083510
[2-(furan-2-yl)-1,3-oxazol-4-yl]methanol (PubChem CID 115083510) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is [2-(furan-2-yl)-1,3-oxazol-4-yl]methanol.
| Compound Name | [2-(furan-2-yl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 115083510 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | [2-(furan-2-yl)-1,3-oxazol-4-yl]methanol |
| SMILES | OCc1coc(-c2ccco2)n1 |
| InChI | InChI=1S/C8H7NO3/c10-4-6-5-12-8(9-6)7-2-1-3-11-7/h1-3,5,10H,4H2 |
| InChIKey | HJYARUVOIRHKKH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 59.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |