C6H10ClNO2 — CID 143299929
(2-chloro-1,3-oxazol-4-yl)methanol;ethane (PubChem CID 143299929) has the molecular formula C6H10ClNO2 and a molecular weight of 163.60 g/mol. Its IUPAC name is (2-chloro-1,3-oxazol-4-yl)methanol;ethane.
| Compound Name | (2-chloro-1,3-oxazol-4-yl)methanol;ethane |
|---|---|
| PubChem CID | 143299929 |
| Molecular Formula | C6H10ClNO2 |
| Molecular Weight | 163.60 g/mol |
| Exact Mass | 163.04 |
| IUPAC Name | (2-chloro-1,3-oxazol-4-yl)methanol;ethane |
| SMILES | CC.OCc1coc(Cl)n1 |
| InChI | InChI=1S/C4H4ClNO2.C2H6/c5-4-6-3(1-7)2-8-4;1-2/h2,7H,1H2;1-2H3 |
| InChIKey | QDIJANSCVYAPEL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.60 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |